[3-[2-(diethylamino)ethyl]-1H-indol-4-yl] acetate structure
|
Common Name | [3-[2-(diethylamino)ethyl]-1H-indol-4-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 1135424-15-5 | Molecular Weight | 274.358 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 429.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4±25.9 °C | |
| Name | [3-[2-(diethylamino)ethyl]-1H-indol-4-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.3±35.0 °C at 760 mmHg |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.358 |
| Flash Point | 213.4±25.9 °C |
| Exact Mass | 274.168121 |
| PSA | 45.33000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | WYEVVQJLTXBMPM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCc1c[nH]c2cccc(OC(C)=O)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indol-4-ol, 3-[2-(diethylamino)ethyl]-, acetate (ester) |
| 3-[2-(Diethylamino)ethyl]-1H-indol-4-yl acetate |
| 4-Acetoxy-DET |
| ethylacybin |
| Ethacetin |
| 3-(2-(Diethylamino)ethyl)-1H-indol-4-yl acetate |
| 4-ACETOXY-N,N-DIETHYLTRYPTAMINE |