3-[2-(Diethylamino)ethyl]-1H-indol-5-ol structure
|
Common Name | 3-[2-(Diethylamino)ethyl]-1H-indol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 14009-42-8 | Molecular Weight | 232.32100 | |
| Density | 1.125g/cm3 | Boiling Point | 413.9ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.1ºC | |
| Name | 3-[2-(Diethylamino)ethyl]-1H-indol-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 413.9ºC at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 204.1ºC |
| Exact Mass | 232.15800 |
| PSA | 39.26000 |
| LogP | 2.75780 |
| Vapour Pressure | 1.93E-07mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | DLKZNHHXBDWTOP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCc1c[nH]c2ccc(O)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Hydroxy diethyl tryptamine |
| Indole-3-ethylamine,N,N-diethyl-5-hydroxy |
| 3-(2-diethylamino-ethyl)-indol-5-ol |
| INDOLE,3-(2-(DIETHYLAMINO)ETHYL)-5-HYDROXY |
| 3-(2-Diaethylamino-aethyl)-indol-5-ol |
| 3-(2-diethylaminoethyl)-1H-indol-5-ol |
| 3-(2-Diethylaminoethyl)-5-hydroxyindole |