Banksialactone A structure
|
Common Name | Banksialactone A | ||
|---|---|---|---|---|
| CAS Number | 1135775-06-2 | Molecular Weight | 268.263 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 544.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2±23.6 °C | |
Use of Banksialactone ABanksialactone A is the metabolite of an Australian fungus, Aspergillus banksianus[1]. |
| Name | Banksialactone A |
|---|---|
| Synonym | More Synonyms |
| Description | Banksialactone A is the metabolite of an Australian fungus, Aspergillus banksianus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.7±50.0 °C at 760 mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.263 |
| Flash Point | 211.2±23.6 °C |
| Exact Mass | 268.094696 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FQHKKOGWSXLRAC-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1C)C(C)C(O)(CO)OC2=O |
| 1H-2-Benzopyran-1-one, 3,4-dihydro-3,8-dihydroxy-3-(hydroxymethyl)-6-methoxy-4,5-dimethyl- |
| Banksialactone A |
| 3,8-Dihydroxy-3-(hydroxymethyl)-6-methoxy-4,5-dimethyl-3,4-dihydro-1H-isochromen-1-one |