2-Methanesulfonyl-4,6-dimethoxypyrimidine structure
|
Common Name | 2-Methanesulfonyl-4,6-dimethoxypyrimidine | ||
|---|---|---|---|---|
| CAS Number | 113583-35-0 | Molecular Weight | 218.230 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 412.6±48.0 °C at 760 mmHg | |
| Molecular Formula | C7H10N2O4S | Melting Point | 129-133 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 203.3±29.6 °C | |
| Name | 2-Methylsulfonyl-4,6-dimethoxypyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.6±48.0 °C at 760 mmHg |
| Melting Point | 129-133 °C(lit.) |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.230 |
| Flash Point | 203.3±29.6 °C |
| Exact Mass | 218.036133 |
| PSA | 86.76000 |
| LogP | -1.20 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | ITDVJJVNAASTRS-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)nc(S(C)(=O)=O)n1 |
| Storage condition | Refrigerator (+4°C) |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~97%
2-Methanesulfon... CAS#:113583-35-0 |
| Literature: Xu, Defeng; Zhu, Zhiling; Xu, Hui; Wang, Ziqiao Asian Journal of Chemistry, 2014 , vol. 26, # 1 p. 313 - 314 |
|
~%
2-Methanesulfon... CAS#:113583-35-0 |
| Literature: Tetrahedron, , vol. 56, # 27 p. 4739 - 4745 |
|
~%
2-Methanesulfon... CAS#:113583-35-0 |
| Literature: Pest Management Science, , vol. 57, # 3 p. 205 - 224 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methylsulfony-4,6-dimethoxypyridine |
| DMMSP |
| 4,6-dimethoxypyrimidin-2-yl methyl sulfone |
| Pyrimidine, 4,6-dimethoxy-2-(methylsulfonyl)- |
| 4,6-Dimethoxy-2-(methylsulfonyl)pyrimidine |
| 4,6-dimethoxy-2-mesyl-pyrimidine |
| 4,6-dimethoxy-2-methylsulfonyl-pyrimidine |
| 2-methylsulfony-4,6-dimethoxypyrimidine |
| MFCD00672151 |
| 2-Methylsulfonyl-4,6 |
| 2-Methylsulfony-4,5-Dimethoxypyridine |
| 2-Methanesulfonyl-4,6-dimethoxypyrimidine |
| DIMETHOXY-2-METHANESULFONYLPYRIMIDINE |
| 2-Methanesulfonyl-4 |
| 2-METHYLSULFONYL-4-6-DIMETHOXY PYRIMIDINE |