beflubutamid structure
|
Common Name | beflubutamid | ||
|---|---|---|---|---|
| CAS Number | 113614-08-7 | Molecular Weight | 355.327 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 496.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H17F4NO2 | Melting Point | 75 °C | |
| MSDS | Chinese USA | Flash Point | 254.1±28.7 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of beflubutamidBeflubutamid is a chiral soil herbicide against dicotyledonous weeds in cereals[1]. |
| Name | beflubutamid |
|---|---|
| Synonym | More Synonyms |
| Description | Beflubutamid is a chiral soil herbicide against dicotyledonous weeds in cereals[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.6±45.0 °C at 760 mmHg |
| Melting Point | 75 °C |
| Molecular Formula | C18H17F4NO2 |
| Molecular Weight | 355.327 |
| Flash Point | 254.1±28.7 °C |
| Exact Mass | 355.119537 |
| PSA | 38.33000 |
| LogP | 4.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | FFQPZWRNXKPNPX-UHFFFAOYSA-N |
| SMILES | CCC(Oc1ccc(F)c(C(F)(F)F)c1)C(=O)NCc1ccccc1 |
| N-Benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]butanamide |
| (RS)-N-benzyl-2-(α,α,α,4-tetrafluoro-m-tolyloxy)butyramide |
| N-Benzyl-2-(a,a,a,4-tetrafluoro-m-tolyloxy)butyramide |
| 2-[4-Fluoro-3-(trifluoromethyl)phenoxy]-N-(phenylmethyl)butanamide |
| Butanamide, 2-[4-fluoro-3-(trifluoromethyl)phenoxy]-N-(phenylmethyl)- |
| rac-(2R)-N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]butanamide |
| beflubutamid |