(3β,6β)-Stigmast-4-ene-3,6-diol structure
|
Common Name | (3β,6β)-Stigmast-4-ene-3,6-diol | ||
|---|---|---|---|---|
| CAS Number | 113626-76-9 | Molecular Weight | 430.71 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 536.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C29H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9±21.4 °C | |
Use of (3β,6β)-Stigmast-4-ene-3,6-diolStigmast-4-ene-3β,6β-diol is a stigmasterol, that can be isolated from Nux Prinsepiae[1]. |
| Name | (3S,6R,8S,9S,10R,13R,14S,17R)-17-((2R,5R)-5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Stigmast-4-ene-3β,6β-diol is a stigmasterol, that can be isolated from Nux Prinsepiae[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.2±38.0 °C at 760 mmHg |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.71 |
| Flash Point | 218.9±21.4 °C |
| Exact Mass | 430.381073 |
| PSA | 40.46000 |
| LogP | 9.20 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | OOUCIUZOGLWLAN-NDDUEHJASA-N |
| SMILES | CCC(CCC(C)C1CCC2C3CC(O)C4=CC(O)CCC4(C)C3CCC12C)C(C)C |
| Hazard Codes | Xi |
|---|
| Stigmast-4-ene-3,6-diol, (3β,6β)- |
| Stigmast-4-ene-3,6-diol |
| (3β,6β)-Stigmast-4-ene-3,6-diol |