N,N-dichloro-4-methoxybenzenesulfonamide structure
|
Common Name | N,N-dichloro-4-methoxybenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 113780-49-7 | Molecular Weight | 256.10600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dichloro-4-methoxybenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7Cl2NO3S |
|---|---|
| Molecular Weight | 256.10600 |
| Exact Mass | 254.95200 |
| PSA | 54.99000 |
| LogP | 3.07430 |
| InChIKey | YZTOPKJWINQAGP-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N(Cl)Cl)cc1 |
|
~76%
N,N-dichloro-4-... CAS#:113780-49-7 |
| Literature: Boberg, Friedrich; Paetz, Andrea; Bruchmann, Bernd; Garming, Alfons Phosphorus and Sulfur and the Related Elements, 1987 , vol. 33, p. 99 - 108 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-dichlor-p-methoxybenzolsulfonamid |
| Benzenesulfonamide,N,N-dichloro-4-methoxy |