Dichloro-4-nitroaniline structure
|
Common Name | Dichloro-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 1331-14-2 | Molecular Weight | 207.014 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 367.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H4Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.0±26.5 °C | |
| Name | N,N-dichloro-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.4±37.0 °C at 760 mmHg |
| Molecular Formula | C6H4Cl2N2O2 |
| Molecular Weight | 207.014 |
| Flash Point | 176.0±26.5 °C |
| Exact Mass | 205.964981 |
| PSA | 49.06000 |
| LogP | 3.00 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | BOHXXTUGYSFUHK-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c(Cl)c1Cl |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Dichloro-4-nitroaniline |
| 2,3-Dichloro-4-nitroaniline |
| BENZENAMINE, 2,3-DICHLORO-4-NITRO- |