Olopatadine structure
|
Common Name | Olopatadine | ||
|---|---|---|---|---|
| CAS Number | 113806-05-6 | Molecular Weight | 337.412 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 523.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1±30.1 °C | |
Use of OlopatadineOlopatadine is an orally active and selective histamine 1 (H1) receptor antagonist and a mast cell stabilizer. Olopatadine prevents immunologically stimulated pro-inflammatory mediator release from human conjunctival mast cells. Olopatadine can be used for researching allergic conjunctivitis[1][2]. |
| Name | Olopatadine |
|---|---|
| Synonym | More Synonyms |
| Description | Olopatadine is an orally active and selective histamine 1 (H1) receptor antagonist and a mast cell stabilizer. Olopatadine prevents immunologically stimulated pro-inflammatory mediator release from human conjunctival mast cells. Olopatadine can be used for researching allergic conjunctivitis[1][2]. |
|---|---|
| Related Catalog | |
| Target |
H1 Receptor |
| In Vitro | Olopatadine inhibits anti-IgE antibody-mediated release of TNF-α from human conjunctival mast cells, and significantly decreases the mast cell supernatant-mediated upregulation of ICAM (intercellular adhesion molecule)-1 on human conjunctival epithelial cells in vitro[2]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 523.0±50.0 °C at 760 mmHg |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.412 |
| Flash Point | 270.1±30.1 °C |
| Exact Mass | 337.167786 |
| PSA | 49.77000 |
| LogP | 3.14 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | JBIMVDZLSHOPLA-LSCVHKIXSA-N |
| SMILES | CN(C)CCC=C1c2ccccc2COc2ccc(CC(=O)O)cc21 |
|
~89%
Olopatadine CAS#:113806-05-6 |
| Literature: WO2006/10459 A1, ; Page/Page column 14-15 ; |
|
~45%
Olopatadine CAS#:113806-05-6 |
| Literature: WO2010/89268 A2, ; Page/Page column 13-14 ; |
|
~99%
Olopatadine CAS#:113806-05-6 |
| Literature: US2007/232814 A1, ; Page/Page column 25; 26 ; |
|
~%
Olopatadine CAS#:113806-05-6 |
| Literature: WO2010/121877 A2, ; Page/Page column 25-26 ; |
|
~%
Olopatadine CAS#:113806-05-6 |
| Literature: EP2385045 A1, ; |
| {(11E)-11-[3-(Dimethylamino)propylidene]-6,11-dihydrodibenzo[b,e]oxepin-2-yl}acetic acid |
| Dibenz[b,e]oxepin-2-acetic acid, 11-[3-(dimethylamino)propylidene]-6,11-dihydro-, (11E)- |
| MFCD00865645 |
| KW 4679 |
| Olopatatadine |