N-(2,5-Dibromopyridin-3-yl)pivalamide structure
|
Common Name | N-(2,5-Dibromopyridin-3-yl)pivalamide | ||
|---|---|---|---|---|
| CAS Number | 1138444-05-9 | Molecular Weight | 336.02300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Br2N2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(2,5-dibromopyridin-3-yl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12Br2N2O |
|---|---|
| Molecular Weight | 336.02300 |
| Exact Mass | 333.93200 |
| PSA | 41.99000 |
| LogP | 3.66420 |
| InChIKey | YAZQPRDSHZOORW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1cc(Br)cnc1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| A-5985 |
| N-(2,5-Dibromopyridin-3-yl)pivalamide |