Diethyl 1,1-Cyclohexanedicarboxylate structure
|
Common Name | Diethyl 1,1-Cyclohexanedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1139-13-5 | Molecular Weight | 228.28500 | |
| Density | 1.071 g/cm3 | Boiling Point | 266.6ºC at 760 mmHg ,137ºC 16mm | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | Diethyl 1,1-Cyclohexanedicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071 g/cm3 |
|---|---|
| Boiling Point | 266.6ºC at 760 mmHg ,137ºC 16mm |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 120.5ºC |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 2.06310 |
| Vapour Pressure | 0.00857mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | MLHUKQNAQSRVKI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCCC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917209090 |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1,1-Cyclohexanedicarboxylic Acid Diethyl Ester |
| Diethyl 1,1-cyclohexanedicarboxylate |
| diethyl cyclohexane-1,1-dicarboxylate |