9-(4-chlorophenyl)sulfonylnon-6-en-2-one structure
|
Common Name | 9-(4-chlorophenyl)sulfonylnon-6-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 114092-06-7 | Molecular Weight | 314.82800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-(4-chlorophenyl)sulfonylnon-6-en-2-one |
|---|
| Molecular Formula | C15H19ClO3S |
|---|---|
| Molecular Weight | 314.82800 |
| Exact Mass | 314.07400 |
| PSA | 59.59000 |
| LogP | 4.90010 |
| InChIKey | WWSLBNRBDMBTRN-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCC=CCCS(=O)(=O)c1ccc(Cl)cc1 |
|
~66%
9-(4-chlorophen... CAS#:114092-06-7 |
| Literature: Ishibashi, Hiroyuki; Uehara, Chiaki; Komatsu, Hajime; Ikeda, Masazumi Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 7 p. 2750 - 2754 |
|
~%
9-(4-chlorophen... CAS#:114092-06-7 |
| Literature: Ishibashi, Hiroyuki; Uehara, Chiaki; Komatsu, Hajime; Ikeda, Masazumi Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 7 p. 2750 - 2754 |
|
~%
9-(4-chlorophen... CAS#:114092-06-7 |
| Literature: Ishibashi, Hiroyuki; Uehara, Chiaki; Komatsu, Hajime; Ikeda, Masazumi Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 7 p. 2750 - 2754 |
|
~%
9-(4-chlorophen... CAS#:114092-06-7 |
| Literature: Ishibashi, Hiroyuki; Uehara, Chiaki; Komatsu, Hajime; Ikeda, Masazumi Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 7 p. 2750 - 2754 |