3-[(4-chlorophenyl)methylidene]-4-thia-1,6-diazabicyclo[3.3.0]oct-5-en-2-one structure
|
Common Name | 3-[(4-chlorophenyl)methylidene]-4-thia-1,6-diazabicyclo[3.3.0]oct-5-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 21108-70-3 | Molecular Weight | 264.73100 | |
| Density | 1.49g/cm3 | Boiling Point | 417.5ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.3ºC | |
| Name | (2E)-2-[(4-chlorophenyl)methylidene]-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-one |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.73100 |
| Flash Point | 206.3ºC |
| Exact Mass | 264.01200 |
| PSA | 62.60000 |
| LogP | 0.46080 |
| Vapour Pressure | 3.54E-07mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | PKSQOHIMBQCWEQ-JXMROGBWSA-N |
| SMILES | O=c1c(=Cc2ccc(Cl)cc2)sc2n1CCN=2 |
|
~%
3-[(4-chlorophe... CAS#:21108-70-3 |
| Literature: Chaudhari,H.S.; Pujari,H.K. Journal of the Indian Chemical Society, 1968 , vol. 45, p. 710 - 713 |
|
~%
3-[(4-chlorophe... CAS#:21108-70-3 |
| Literature: Mohan, Jag; Kiran Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 9 p. 898 - 900 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |