1,5-dichloro-2-nitro-4-phenylmethoxybenzene structure
|
Common Name | 1,5-dichloro-2-nitro-4-phenylmethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 114109-50-1 | Molecular Weight | 298.12100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dichloro-2-nitro-4-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9Cl2NO3 |
|---|---|
| Molecular Weight | 298.12100 |
| Exact Mass | 296.99600 |
| PSA | 55.05000 |
| LogP | 5.00380 |
| InChIKey | IEKKEZUAADAJGO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(OCc2ccccc2)c(Cl)cc1Cl |
|
~96%
1,5-dichloro-2-... CAS#:114109-50-1 |
| Literature: VERNALIS (R and D) Ltd.; CANCER RESEARCH TECHNOLOGY LTD; THE INSTITUTE OF CANCER RESEARCH Patent: WO2007/34185 A1, 2007 ; Location in patent: Page/Page column 30-31 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| benzyldichloronitrophenylether |
| 1-benzyloxy-2,4-dichloro-5-nitrobenzene |