2,4-dichloro-5-phenylmethoxyaniline structure
|
Common Name | 2,4-dichloro-5-phenylmethoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 338960-25-1 | Molecular Weight | 268.13900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11Cl2NO | Melting Point | 102-105ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dichloro-5-phenylmethoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 102-105ºC |
|---|---|
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.13900 |
| Exact Mass | 267.02200 |
| PSA | 35.25000 |
| LogP | 4.73580 |
| InChIKey | OUOCSSKTOYFHRE-UHFFFAOYSA-N |
| SMILES | Nc1cc(OCc2ccccc2)c(Cl)cc1Cl |
| HS Code | 2922199090 |
|---|
|
~98%
2,4-dichloro-5-... CAS#:338960-25-1 |
| Literature: VERNALIS (R and D) Ltd.; CANCER RESEARCH TECHNOLOGY LTD; THE INSTITUTE OF CANCER RESEARCH Patent: WO2007/34185 A1, 2007 ; Location in patent: Page/Page column 31 ; |
|
~%
2,4-dichloro-5-... CAS#:338960-25-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 22 p. 6770 - 6789 |
|
~%
2,4-dichloro-5-... CAS#:338960-25-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 22 p. 6770 - 6789 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(benzyloxy)-2,4-dichloroalanine |
| 5-benzyloxy-2,4-dichlorophenylamine |
| 1-benzyloxy-2,4-dichlorophenylamine |
| 5-(benzyloxy)-2,4-dichloroaniline |
| benzyloxydichloroaniline |