4-[4-hydroxy-1-(4-hydroxyphenyl)cyclohexyl]phenol structure
|
Common Name | 4-[4-hydroxy-1-(4-hydroxyphenyl)cyclohexyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 114216-05-6 | Molecular Weight | 284.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-hydroxy-1-(4-hydroxyphenyl)cyclohexyl]phenol |
|---|
| Molecular Formula | C18H20O3 |
|---|---|
| Molecular Weight | 284.35000 |
| Exact Mass | 284.14100 |
| PSA | 60.69000 |
| LogP | 3.31880 |
| InChIKey | JTJBAXVMAPZCOD-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)CCC(O)CC2)cc1 |
|
~%
4-[4-hydroxy-1-... CAS#:114216-05-6 |
| Literature: Kolasa; Gunn; Bhatia; Basha; Craig; Stewart; Bouska; Harris; Hulkower; Malo; Bell; Carter; Brooks Journal of Medicinal Chemistry, 2000 , vol. 43, # 17 p. 3322 - 3334 |
|
~%
4-[4-hydroxy-1-... CAS#:114216-05-6 |
| Literature: Kolasa; Gunn; Bhatia; Basha; Craig; Stewart; Bouska; Harris; Hulkower; Malo; Bell; Carter; Brooks Journal of Medicinal Chemistry, 2000 , vol. 43, # 17 p. 3322 - 3334 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |