2-[(3-Fluorophenoxy)methyl]benzoic acid structure
|
Common Name | 2-[(3-Fluorophenoxy)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 114312-47-9 | Molecular Weight | 246.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(3-Fluorophenoxy)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11FO3 |
|---|---|
| Molecular Weight | 246.23400 |
| Exact Mass | 246.06900 |
| PSA | 46.53000 |
| LogP | 3.10290 |
| InChIKey | MRHZIOQBQSNKPJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1COc1cccc(F)c1 |
|
~48%
2-[(3-Fluorophe... CAS#:114312-47-9 |
| Literature: Laufer, Stefan A.; Ahrens, Gabriele M.; Karcher, Solveigh C.; Hering, Joerg S.; Niess, Raimund Journal of Medicinal Chemistry, 2006 , vol. 49, # 26 p. 7912 - 7915 |
|
~74%
2-[(3-Fluorophe... CAS#:114312-47-9 |
| Literature: Kurokawa; Sato; Masuda; Yoshida; Ochi; Zushi; Fujiwara; Naruto; Uno; Matsumoto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2564 - 2573 |
|
~47%
2-[(3-Fluorophe... CAS#:114312-47-9 |
| Literature: MERCKLE GMBH Patent: WO2006/120010 A2, 2006 ; Location in patent: Page/Page column 23; 35-36 ; |
| Ethanamine,2-(3-fluorophenoxy) |
| 2-(3-fluorophenoxy)ethylamine |
| 2-[(3-fluorophenyloxy)methyl]benzoic acid |
| 2-(3-fluorophenoxymethyl)-benzoic acid |
| 2-(3-fluorophenoxy)ethylamine hydrochloride |
| 1-(2-aminoethoxy)-3-fluorobenzene |