(1S,2R)-2-(Dibutylamino)-1-phenyl-1-propanol structure
|
Common Name | (1S,2R)-2-(Dibutylamino)-1-phenyl-1-propanol | ||
|---|---|---|---|---|
| CAS Number | 114389-70-7 | Molecular Weight | 263.418 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 373.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C17H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.9±21.2 °C | |
| Name | (1S,2R)-2-(Dibutylamino)-1-phenyl-1-propanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.6±30.0 °C at 760 mmHg |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.418 |
| Flash Point | 139.9±21.2 °C |
| Exact Mass | 263.224915 |
| PSA | 23.47000 |
| LogP | 4.93 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | BRRGNOFUBFINSX-NVXWUHKLSA-N |
| SMILES | CCCCN(CCCC)C(C)C(O)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922199090 |
|
~67%
(1S,2R)-2-(Dibu... CAS#:114389-70-7 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 13 p. 4264 - 4268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (1S,2R)-2-(Dibutylamino)-1-phenyl-1-propanol |
| (1S,2R)-2-(Dibutylamino)-1-phenylpropan-1-ol |
| Benzenemethanol, α-[(1R)-1-(dibutylamino)ethyl]-, (αS)- |
| (-)-α-[1-(Dibutylamino)ethyl]benzyl Alcohol |
| (-)-N,N-Dibutylnorephedrin |
| MFCD00142695 |