3-Oxobutyric acid menthyl ester structure
|
Common Name | 3-Oxobutyric acid menthyl ester | ||
|---|---|---|---|---|
| CAS Number | 1144-50-9 | Molecular Weight | 240.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-2-(1-methylethyl)cyclohexyl-3-oxo butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H24O3 |
|---|---|
| Molecular Weight | 240.33900 |
| Exact Mass | 240.17300 |
| PSA | 43.37000 |
| LogP | 2.96950 |
| InChIKey | QSVQIPXQOCAWHP-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OC1CC(C)CCC1C(C)C |
| HS Code | 2918300090 |
|---|
|
~79%
3-Oxobutyric ac... CAS#:1144-50-9 |
| Literature: Hagiwara, Hisahiro; Koseki, Aiko; Isobe, Kohei; Shimizu, Ken-Ichi; Hoshi, Takashi; Suzuki, Toshio Synlett, 2004 , # 12 p. 2188 - 2190 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| acetoacetic acid menthyl ester |
| MENTHOL ACETOACETATE |
| menthyl acetoacetate |
| Acetessigsaeure-menthylester |