Cyanine5.5 carboxylic acid structure
|
Common Name | Cyanine5.5 carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1144107-80-1 | Molecular Weight | 582.774 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H42N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyanine5.5 carboxylic acidCY5.5 carboxylic acid, also known as Cyanine5.5 carboxylic acid, is a Far-red emitting fluorescent dye with Ex/Em wavelength 673nm/707nm. CY5.5 carboxylic acid can be considered non-reactive for most applications and used as a control or reference sample, and for instrument calibration. |
| Name | CY5.5-COOH |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H42N2O2 |
|---|---|
| Molecular Weight | 582.774 |
| Exact Mass | 582.324646 |
| InChIKey | UFNAFNWOXFAMSM-UHFFFAOYSA-N |
| SMILES | C[N+]1=C(C=CC=CC=C2N(CCCCCC(=O)O)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21.[Cl-] |
| Storage condition | -20°C |
| 1H-Benz[e]indolium, 3-(5-carboxypentyl)-2-[(1E,3E,5E)-5-(1,3-dihydro-1,1,3-trimethyl-2H-benz[e]indol-2-ylidene)-1,3-pentadien-1-yl]-1,1-dimethyl-, inner salt |
| 6-{1,1-Dimethyl-2-[(1E,3E,5E)-5-(1,1,3-trimethyl-1,3-dihydro-2H-benzo[e]indol-2-ylidene)-1,3-pentadien-1-yl]-1H-benzo[e]indolium-3-yl}hexanoate |