phenanthrene-2-carboxylic acid structure
|
Common Name | phenanthrene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 40452-20-8 | Molecular Weight | 222.23900 | |
| Density | 1.305 | Boiling Point | 435.367ºC at 760 mmHg | |
| Molecular Formula | C15H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenanthrene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305 |
|---|---|
| Boiling Point | 435.367ºC at 760 mmHg |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.23900 |
| Exact Mass | 222.06800 |
| PSA | 37.30000 |
| LogP | 3.69120 |
| Index of Refraction | 1.743 |
| InChIKey | QTWYUOSZMIWHJV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(ccc3ccccc32)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Phenanthrenecarboxylicacid |
| Phenanthren-2-carbonsaeure |
| 2-carboxyphenanthrene |