Regaloside B structure
|
Common Name | Regaloside B | ||
|---|---|---|---|---|
| CAS Number | 114420-67-6 | Molecular Weight | 442.41400 | |
| Density | 1.46g/cm3 | Boiling Point | 727.5ºC at 760mmHg | |
| Molecular Formula | C20H26O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.8ºC | |
Use of Regaloside BRegaloside B is a phenylpropanoid isolated from Lilium longiflorum. Regaloside B can inhibit the expression of iNOS and COX-2, has anti-inflammatory activity[1][2]. |
| Name | [(2S)-3-acetyloxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Regaloside B is a phenylpropanoid isolated from Lilium longiflorum. Regaloside B can inhibit the expression of iNOS and COX-2, has anti-inflammatory activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 727.5ºC at 760mmHg |
| Molecular Formula | C20H26O11 |
| Molecular Weight | 442.41400 |
| Flash Point | 253.8ºC |
| Exact Mass | 442.14800 |
| PSA | 172.21000 |
| Vapour Pressure | 3.23E-22mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | YQKQOLPNKNHLBO-KRJCNZRASA-N |
| SMILES | CC(=O)OCC(COC(=O)C=Cc1ccc(O)cc1)OC1OC(CO)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Water Solubility | Sparingly soluble (11 g/L) (25 ºC) |
| Regaloside B |