2-(4-methylphenyl)-3-(4-nitrobenzoyl)-2H-1,3-benzoxazin-4-one structure
|
Common Name | 2-(4-methylphenyl)-3-(4-nitrobenzoyl)-2H-1,3-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 114439-75-7 | Molecular Weight | 388.37300 | |
| Density | 1.366g/cm3 | Boiling Point | 624.9ºC at 760 mmHg | |
| Molecular Formula | C22H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.7ºC | |
| Name | 2-(4-methylphenyl)-3-(4-nitrobenzoyl)-2H-1,3-benzoxazin-4-one |
|---|
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 624.9ºC at 760 mmHg |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.37300 |
| Flash Point | 331.7ºC |
| Exact Mass | 388.10600 |
| PSA | 92.43000 |
| LogP | 4.73810 |
| Vapour Pressure | 1.56E-15mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | RUFGRTICHGABTF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2Oc3ccccc3C(=O)N2C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
2-(4-methylphen... CAS#:114439-75-7 |
| Literature: Husain; Amir Journal of the Indian Chemical Society, 1987 , vol. 64, # 6 p. 351-353 |
|
~%
2-(4-methylphen... CAS#:114439-75-7 |
| Literature: Husain; Amir Journal of the Indian Chemical Society, 1987 , vol. 64, # 6 p. 351-353 |
|
~%
2-(4-methylphen... CAS#:114439-75-7 |
| Literature: Husain; Amir Journal of the Indian Chemical Society, 1987 , vol. 64, # 6 p. 351-353 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |