tert-butyl-dimethyl-(1-tributylstannylhexoxy)silane structure
|
Common Name | tert-butyl-dimethyl-(1-tributylstannylhexoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 114551-33-6 | Molecular Weight | 505.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H54OSiSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-dimethyl-(1-tributylstannylhexoxy)silane |
|---|
| Molecular Formula | C24H54OSiSn |
|---|---|
| Molecular Weight | 505.47100 |
| Exact Mass | 506.29700 |
| PSA | 9.23000 |
| LogP | 8.94490 |
| InChIKey | TXVXRNDBWHPEJQ-UHFFFAOYSA-N |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)[Sn](CCCC)(CCCC)CCCC |
|
~61%
tert-butyl-dime... CAS#:114551-33-6 |
| Literature: Antonsen, Oeyvind; Benneche, Tore; Gundersen, Lise-Lotte; Undheim, Kjell Acta Chemica Scandinavica, 1992 , vol. 46, # 2 p. 172 - 177 |
|
~%
tert-butyl-dime... CAS#:114551-33-6 |
| Literature: Linderman, Russell J.; Ghannam, Ameen Journal of the American Chemical Society, 1990 , vol. 112, # 6 p. 2392 - 2398 |