(Des-Gly)-Glutathione-monoethyl ester (reduced) structure
|
Common Name | (Des-Gly)-Glutathione-monoethyl ester (reduced) | ||
|---|---|---|---|---|
| CAS Number | 114627-30-4 | Molecular Weight | 278.32500 | |
| Density | 1.287g/cm3 | Boiling Point | 519.8ºC at 760mmHg | |
| Molecular Formula | C10H18N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.2ºC | |
| Name | (2S)-2-amino-5-[[(2R)-1-ethoxy-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 519.8ºC at 760mmHg |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.32500 |
| Flash Point | 268.2ºC |
| Exact Mass | 278.09400 |
| PSA | 161.01000 |
| LogP | 0.69680 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | IVEKVTHFAJJKGA-BQBZGAKWSA-N |
| SMILES | CCOC(=O)C(CS)NC(=O)CCC(N)C(=O)O |
|
~%
(Des-Gly)-Gluta... CAS#:114627-30-4 |
| Literature: Nagasawa, Herbert T.; Cohen, Jonathan F.; Holleschau, Ann M.; Rathbun, William B. Journal of Medicinal Chemistry, 1996 , vol. 39, # 8 p. 1676 - 1681 |
|
~%
(Des-Gly)-Gluta... CAS#:114627-30-4 |
| Literature: Nagasawa, Herbert T.; Cohen, Jonathan F.; Holleschau, Ann M.; Rathbun, William B. Journal of Medicinal Chemistry, 1996 , vol. 39, # 8 p. 1676 - 1681 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Glu-cys-oet |
| (Des-Gly)-Glutathione-monoethyl ester (reduced) |