2-(4-iodophenyl)indene-1,3-dione structure
|
Common Name | 2-(4-iodophenyl)indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1147-00-8 | Molecular Weight | 348.13500 | |
| Density | 1.76g/cm3 | Boiling Point | 464.7ºC at 760 mmHg | |
| Molecular Formula | C15H9IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.8ºC | |
| Name | 2-(4-iodophenyl)indene-1,3-dione |
|---|
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 464.7ºC at 760 mmHg |
| Molecular Formula | C15H9IO2 |
| Molecular Weight | 348.13500 |
| Flash Point | 234.8ºC |
| Exact Mass | 347.96500 |
| PSA | 34.14000 |
| LogP | 3.45400 |
| Vapour Pressure | 8.18E-09mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | UTLQYSLZKWYNOX-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1c1ccc(I)cc1 |
|
~%
2-(4-iodophenyl... CAS#:1147-00-8 |
| Literature: Koelsch Journal of the American Chemical Society, 1936 , vol. 58, p. 1331 |
|
~%
2-(4-iodophenyl... CAS#:1147-00-8 |
| Literature: Koelsch Journal of the American Chemical Society, 1936 , vol. 58, p. 1331 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |