2-(4-methoxybenzoyl)indene-1,3-dione structure
|
Common Name | 2-(4-methoxybenzoyl)indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 147847-17-4 | Molecular Weight | 280.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methoxybenzoyl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H12O4 |
|---|---|
| Molecular Weight | 280.27500 |
| Exact Mass | 280.07400 |
| PSA | 60.44000 |
| LogP | 2.57330 |
| InChIKey | NJSFXAKMNPVRCR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C2C(=O)c3ccccc3C2=O)cc1 |
| HS Code | 2914509090 |
|---|
|
~51%
2-(4-methoxyben... CAS#:147847-17-4 |
| Literature: Nugiel, David A.; Vidwans, Anup; Etzkorn, Anna-Marie; Rossi, Karen A.; Benfield, Pamela A.; Burton, Catherine R.; Cox, Sarah; Doleniak, Deborah; Seitz, Steven P. Journal of Medicinal Chemistry, 2002 , vol. 45, # 24 p. 5224 - 5232 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(4-methoxybenzoyl)indan-1,3-dione |
| 2-(4-Methoxy-benzoyl)-indan-1,3-dion |
| 1H-Indene-1,3(2H)-dione,2-(4-methoxybenzoyl) |
| 2-(p-Methoxybenzoyl)-indandion-1-3 |