6,6'-Dibromo-N,N'-(2-ethylhexyl)isoindigo structure
|
Common Name | 6,6'-Dibromo-N,N'-(2-ethylhexyl)isoindigo | ||
|---|---|---|---|---|
| CAS Number | 1147124-23-9 | Molecular Weight | 644.48000 | |
| Density | N/A | Boiling Point | 689 °C | |
| Molecular Formula | C32H40Br2N2O2 | Melting Point | 112 °C | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ehid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 689 °C |
|---|---|
| Melting Point | 112 °C |
| Molecular Formula | C32H40Br2N2O2 |
| Molecular Weight | 644.48000 |
| Exact Mass | 642.14600 |
| PSA | 40.62000 |
| LogP | 9.37840 |
| InChIKey | HUEXOUHCCSVYLP-FLWNBWAVSA-N |
| SMILES | CCCCC(CC)CN1C(=O)C(=C2C(=O)N(CC(CC)CCCC)c3cc(Br)ccc32)c2ccc(Br)cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
Structure-property relationship study of substitution effects on isoindigo-based model compounds as electron donors in organic solar cells.
ACS Appl. Mater. Interfaces 6(16) , 14533-14542, (2014) We designed and synthesized a series of isoindigo-based derivatives to investigate how chemical structure modification at both the 6,6'- and 5,5'-positions of the core with electron-rich and electron-... |
|
|
Isoindigo-based copolymers for polymer solar cells with efficiency over 7%. Ho CC, et al.
J. Mater. Chem. A 2(21) , 8026-8032, (2014)
|
|
|
Synthesis of isoindigo-based oligothiophenes for molecular bulk heterojunction solar cells. Mei J, et al.
Org. Lett. 12(4) , 660-663, (2010)
|
| 6,6'-dibromo-N,N'-bis(2-ethylhexyl)-isoindigo |
| 6,60-dibromo-N,N'-(1-ethylhexyl)isoindigo |
| 6,6'-dibromo-N,N'-di(2-ethylhexyl)-isoindigo |
| 6,6'-dibromo-N,N'-(2-ethylhexyl)-isoindigo |
| 1,1'-bis(2-ethylhexyl)-6,6'-dibromoisoindigo |
| 6,6'-dibromo-N,N'-(2-ethylhexyl)isoindigo |