7-TFA-ap-7-Deaza-ddA structure
|
Common Name | 7-TFA-ap-7-Deaza-ddA | ||
|---|---|---|---|---|
| CAS Number | 114748-71-9 | Molecular Weight | 383.325 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 650.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H16F3N5O3 | Melting Point | 167-169 °C(Solv: ethyl ether (60-29-7)) | |
| MSDS | N/A | Flash Point | 347.4±31.5 °C | |
Use of 7-TFA-ap-7-Deaza-ddA7-TFA-ap-7-Deaza-ddA (compound 19c, US20060281100A1), a nucleotide derivative, can be used in the synthesis of thiotriphosphate nucleotide dye terminators which can be used in DNA sequencing reactions[1]. |
| Name | 7-TFA-ap-7-Deaza-ddA |
|---|---|
| Synonym | More Synonyms |
| Description | 7-TFA-ap-7-Deaza-ddA (compound 19c, US20060281100A1), a nucleotide derivative, can be used in the synthesis of thiotriphosphate nucleotide dye terminators which can be used in DNA sequencing reactions[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Shen G, et, al. Thiotriphosphate nucleotide dye terminators. US20060281100A1. |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 650.9±55.0 °C at 760 mmHg |
| Melting Point | 167-169 °C(Solv: ethyl ether (60-29-7)) |
| Molecular Formula | C16H16F3N5O3 |
| Molecular Weight | 383.325 |
| Flash Point | 347.4±31.5 °C |
| Exact Mass | 383.120514 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | WUXCPWCITSUNMX-WDEREUQCSA-N |
| SMILES | Nc1ncnc2c1c(C#CCNC(=O)C(F)(F)F)cn2C1CCC(CO)O1 |
| Storage condition | 2-8℃ |
| N-(3-{4-Amino-7-[(2R,5S)-5-(hydroxymethyl)tetrahydro-2-furanyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl}-2-propyn-1-yl)-2,2,2-trifluoroacetamide |
| Acetamide, N-[3-[4-amino-7-[(2R,5S)-tetrahydro-5-(hydroxymethyl)-2-furanyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2-propyn-1-yl]-2,2,2-trifluoro- |