3-amino-4-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione structure
|
Common Name | 3-amino-4-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 114752-07-7 | Molecular Weight | 313.44000 | |
| Density | 1.48g/cm3 | Boiling Point | 541.8ºC at 760 mmHg | |
| Molecular Formula | C16H15N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5ºC | |
| Name | 3-amino-4-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 541.8ºC at 760 mmHg |
| Molecular Formula | C16H15N3S2 |
| Molecular Weight | 313.44000 |
| Flash Point | 281.5ºC |
| Exact Mass | 313.07100 |
| PSA | 104.17000 |
| LogP | 4.66810 |
| Vapour Pressure | 8.41E-12mmHg at 25°C |
| Index of Refraction | 1.796 |
| InChIKey | YGYWRDDZUCMKLP-UHFFFAOYSA-N |
| SMILES | Nn1c(-c2ccccc2)c2c3c(sc2nc1=S)CCCC3 |
|
~90%
3-amino-4-pheny... CAS#:114752-07-7 |
| Literature: Vega; Alonso; Diaz; Junquera Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 2 p. 269 - 273 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3-Amino-4-phenyl-2-thioxo-2,3,5,6,7,8-hexahydrobenzo<4,5>thieno<2,3-d>pyrimidine |