3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione structure
|
Common Name | 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 128352-86-3 | Molecular Weight | 315.45600 | |
| Density | 1.41g/cm3 | Boiling Point | 457.5ºC at 760 mmHg | |
| Molecular Formula | C16H17N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 457.5ºC at 760 mmHg |
| Molecular Formula | C16H17N3S2 |
| Molecular Weight | 315.45600 |
| Flash Point | 230.5ºC |
| Exact Mass | 315.08600 |
| PSA | 108.66000 |
| LogP | 3.89670 |
| Vapour Pressure | 1.48E-08mmHg at 25°C |
| Index of Refraction | 1.756 |
| InChIKey | ZLCMFDBBUZTCBS-UHFFFAOYSA-N |
| SMILES | NN1C(=S)Nc2sc3c(c2C1c1ccccc1)CCCC3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 6 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Related downstream products(CAS) of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione: 135718-62-6;135718-67-1;136541-58-7;135718-64-8;135718-57-9;135718-65-9. |
| Q: What is the boiling point of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Boiling point of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 457.5ºC at 760 mmHg. |
| Q: What is the SMILES notation of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: SMILES notation of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is NN1C(=S)Nc2sc3c(c2C1c1ccccc1)CCCC3. |
| Q: What is the molecular formula of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Molecular formula of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is C16H17N3S2. |
| Q: What are the upstream materials of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Related upstream materials(CAS) of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione: 114752-07-7;119934-31-5. |
| Q: What is the Chinese name of 128352-86-3? |
| A: Chinese name of 128352-86-3 is 128352-86-3. |
| Q: What is the InChIKey of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: InChIKey of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is ZLCMFDBBUZTCBS-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: LogP of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 3.89670. |
| Q: What is the CAS number of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: CAS number of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 128352-86-3. |
| Q: What is the molecular weight of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Molecular weight of 3-amino-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 315.45600. |