Methyl 2-[4-(bromomethyl)benzoyl]benzoate structure
|
Common Name | Methyl 2-[4-(bromomethyl)benzoyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 114772-96-2 | Molecular Weight | 333.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2-[4-(bromomethyl)benzoyl]benzoate |
|---|
| Molecular Formula | C16H13BrO3 |
|---|---|
| Molecular Weight | 333.17700 |
| Exact Mass | 332.00500 |
| PSA | 43.37000 |
| LogP | 3.59910 |
| InChIKey | QTAFIJHJKANVIY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1C(=O)c1ccc(CBr)cc1 |
|
~80%
Methyl 2-[4-(br... CAS#:114772-96-2 |
| Literature: Jones, Paul B.; Porter, Ned A. Journal of the American Chemical Society, 1999 , vol. 121, # 12 p. 2753 - 2761 |