n-boc-3-(3-methyl-4-nitrobenzyl)-l- structure
|
Common Name | n-boc-3-(3-methyl-4-nitrobenzyl)-l- | ||
|---|---|---|---|---|
| CAS Number | 114787-83-6 | Molecular Weight | 418.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26N4O6 | Melting Point | 92-104 °C(lit.) | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of n-boc-3-(3-methyl-4-nitrobenzyl)-l-N-Boc-3-(3-methyl-4-nitrobenzyl)-L-histidine methyl ester is a histidine derivative[1]. |
| Name | N-<(1,1-dimethylethoxy)carbonyl>-3-<(3-methyl-4-nitrophenyl)methyl>-L-histidine methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-3-(3-methyl-4-nitrobenzyl)-L-histidine methyl ester is a histidine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Melting Point | 92-104 °C(lit.) |
|---|---|
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.44400 |
| Flash Point | >230 °F |
| Exact Mass | 418.18500 |
| PSA | 128.27000 |
| LogP | 3.67090 |
| Vapour Pressure | 1.96E-15mmHg at 25°C |
| InChIKey | GQACPDRFESBMPS-INIZCTEOSA-N |
| SMILES | COC(=O)C(Cc1cncn1Cc1ccc([N+](=O)[O-])c(C)c1)NC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| n-boc-3-(3-methyl-4-nitrobenzyl)-l-histidine methyl ester |