2,2':6',2''-TERPYRIDINE structure
|
Common Name | 2,2':6',2''-TERPYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 1148-79-4 | Molecular Weight | 233.268 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 402.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C15H11N3 | Melting Point | 90-93 °C | |
| MSDS | Chinese USA | Flash Point | 182.5±18.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2,2':6',2''-terpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.3±35.0 °C at 760 mmHg |
| Melting Point | 90-93 °C |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.268 |
| Flash Point | 182.5±18.9 °C |
| Exact Mass | 233.095291 |
| PSA | 38.67000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | DRGAZIDRYFYHIJ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cccc(-c3ccccn3)n2)nc1 |
| Water Solubility | dioxane: 0.1 g/mL, clear |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H310-H315-H318-H335 |
| Precautionary Statements | P261-P264-P280-P302 + P350-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+: Very toxic; |
| Risk Phrases | R27/28 |
| Safety Phrases | S26-S28-S36/37/39-S45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| Packaging Group | I |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Thousands of chemical starting points for antimalarial lead identification.
Nature 465 , 305-10, (2010) Malaria is a devastating infection caused by protozoa of the genus Plasmodium. Drug resistance is widespread, no new chemical class of antimalarials has been introduced into clinical practice since 19... |
|
|
Metal complexes with superoxide dismutase-like activity as candidates for anti-prion drug.
Bioorg. Med. Chem. Lett. 16 , 5982-7, (2006) Various compounds were evaluated for ability to inhibit the formation of the abnormal protease-resistant form of prion protein (PrP-res) in two cell lines infected with different prion strains. Examin... |
|
|
In silico activity profiling reveals the mechanism of action of antimalarials discovered in a high-throughput screen.
Proc. Natl. Acad. Sci. U. S. A. 105 , 9059-64, (2008) The growing resistance to current first-line antimalarial drugs represents a major health challenge. To facilitate the discovery of new antimalarials, we have implemented an efficient and robust high-... |
| 2,2′﹕6′,2′′-Terpyridine |
| 2,2′:6′,2′′-Terpyridine |
| EINECS 214-559-5 |
| tcmdc-123985 |
| terpy |
| 2,2',2''-Terpyridine |
| α,α',α''-Tripyridyl |
| 2,6-Di(2-pyridyl)pyridine |
| 2,2':6',2''-Terpyridine |
| Terpyridine |
| 2,6-dipyridin-2-ylpyridine |
| MFCD00006213 |