4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one structure
|
Common Name | 4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 114857-82-8 | Molecular Weight | 310.77800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
|---|
| Molecular Formula | C18H15ClN2O |
|---|---|
| Molecular Weight | 310.77800 |
| Exact Mass | 310.08700 |
| PSA | 44.62000 |
| LogP | 4.02020 |
| InChIKey | TVJDKKRUHAPWQB-UHFFFAOYSA-N |
| SMILES | O=C1NC2=C(CCc3ccccc32)C(c2ccc(Cl)cc2)N1 |
|
~91%
4-(4-chlorophen... CAS#:114857-82-8 |
| Literature: Mirza-Aghayan; Moradi; Bolourtchian Journal of the Iranian Chemical Society, 2010 , vol. 7, # 1 p. 269 - 274 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |