pentafluorobenzyl methacrylate structure
|
Common Name | pentafluorobenzyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 114859-23-3 | Molecular Weight | 266.16400 | |
| Density | 1.392g/cm3 | Boiling Point | 235.3ºC at 760mmHg | |
| Molecular Formula | C11H7F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.3ºC | |
| Name | [difluoro-(2,3,4-trifluorophenyl)methyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 235.3ºC at 760mmHg |
| Molecular Formula | C11H7F5O2 |
| Molecular Weight | 266.16400 |
| Flash Point | 96.3ºC |
| Exact Mass | 266.03700 |
| PSA | 26.30000 |
| LogP | 3.00140 |
| Vapour Pressure | 0.0505mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | DSESELHEBRQXBA-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | Keep Cold |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
|
~%
pentafluorobenz... CAS#:114859-23-3 |
| Literature: Chien, Chao-Jung; Charles, M. Judith; Sexton, Kenneth G.; Jeffries, Harvey E. Environmental Science and Technology, 1998 , vol. 32, # 2 p. 299 - 309 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| pentafluorobenzyl ester of methacrylic acid |
| MFCD00042329 |