D-2,4-Dichlorophenylalanine structure
|
Common Name | D-2,4-Dichlorophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 114872-98-9 | Molecular Weight | 234.079 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 368.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.4±27.9 °C | |
Use of D-2,4-Dichlorophenylalanine2,4-Dichloro-D-phenylalanine is a phenylalanine derivative[1]. |
| Name | 2,4-Dichloro-D-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Description | 2,4-Dichloro-D-phenylalanine is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.1±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.079 |
| Flash Point | 176.4±27.9 °C |
| Exact Mass | 233.001038 |
| PSA | 63.32000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | GWHQTNKPTXDNRM-MRVPVSSYSA-N |
| SMILES | NC(Cc1ccc(Cl)cc1Cl)C(=O)O |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2922499990 |
|
~49%
D-2,4-Dichlorop... CAS#:114872-98-9 |
| Literature: Zhang, Zizhang Tetrahedron Letters, 2008 , vol. 49, # 45 p. 6468 - 6470 |
|
~%
D-2,4-Dichlorop... CAS#:114872-98-9 |
| Literature: Synthetic Communications, , vol. 43, # 21 p. 2892 - 2897 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Inhibition of HDAC8 (unknown origin)
Source: ChEMBL
Target: Histone deacetylase 8
External Id: CHEMBL4617410
|
| 3,4-Dichlorophenylalanine |
| 2,4-Dichloro-D-phenylalanine |
| 2,4-Dichlor-L-phenylalanin |
| (2S)-2-amino-3-(3,4-dichlorophenyl)propanoic acid |
| L-2,4-Dichlorophenylalanine |
| (2S)-2-amino-3-(2,4-dichlorophenyl)propanoic acid |
| D-2,4-DICHLOROPHENYLALANINE |
| 3,4-Dichlor-L-phenylalanin |
| 3,4-Dichloro-L-phenylalanine |
| 2,4-Dichlor-D-phenylalanin |
| (2R)-2-amino-3-(2,4-dichlorophenyl)propanoic acid |
| 2,4-Dichloro-L-phenylalanine |
| MFCD01860873 |
| 2,4-Dichlorophenylalanine |