3,5-Diethoxycarbonyl-2,6-dimethylpyridine structure
|
Common Name | 3,5-Diethoxycarbonyl-2,6-dimethylpyridine | ||
|---|---|---|---|---|
| CAS Number | 1149-24-2 | Molecular Weight | 251.278 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | 72-74ºC(lit.) | |
| MSDS | USA | Flash Point | 141.0±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.5±0.0 °C at 760 mmHg |
| Melting Point | 72-74ºC(lit.) |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.278 |
| Flash Point | 141.0±26.5 °C |
| Exact Mass | 251.115753 |
| PSA | 65.49000 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | DIIWSYPKAJVXBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c(C)nc1C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Aromatization of 1, 4-dihydropyridines in the presence of methanesulfonic acid/NaNO2/wet SiO2 under both heterogeneous and solvent free conditions. Niknam K, et al.
J. Heterocycl. Chem. 43(1) , 199, (2006)
|
|
|
Photooxidation of 1, 4-dihydropyridines. Mitsunobu O, et al.
Bull. Chem. Soc. Jpn. 45 , 1453-1457, (1972)
|
| diethyl 2,6-dimethylpyridine-3,5-dicarboxylate |
| DIETHYL 2,6-DIMETHYL-3,5-PYRIDINEDICARBOXYLATE |
| MFCD00023506 |
| 2,6-Dimethyl-pyridine-3,5-dicarboxylic acid diethyl ester |
| 3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-, diethyl ester |
| 3,5-Diethoxycarbonyl-2,6-dimethylpyridine |