Phenol,4-[2-(2-pyridinyl)ethenyl]-, 1-acetate structure
|
Common Name | Phenol,4-[2-(2-pyridinyl)ethenyl]-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 1149-57-1 | Molecular Weight | 239.26900 | |
| Density | 1.175g/cm3 | Boiling Point | 377.9ºC at 760mmHg | |
| Molecular Formula | C15H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | [4-(2-pyridin-2-ylethenyl)phenyl] acetate |
|---|
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760mmHg |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.26900 |
| Flash Point | 182.4ºC |
| Exact Mass | 239.09500 |
| PSA | 39.19000 |
| LogP | 3.17730 |
| Vapour Pressure | 6.53E-06mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | KSTDUJJGAWWLFZ-VMPITWQZSA-N |
| SMILES | CC(=O)Oc1ccc(C=Cc2ccccn2)cc1 |
|
~61%
Phenol,4-[2-(2-... CAS#:1149-57-1 |
| Literature: Molecular Crystals and Liquid Crystals, , vol. 514, p. 235 - 248 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |