Ciwujianoside B structure
|
Common Name | Ciwujianoside B | ||
|---|---|---|---|---|
| CAS Number | 114902-16-8 | Molecular Weight | 1187.363 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C59H94O24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ciwujianoside BCiwujianoside B is isolated from Eleutherococcus senticosus leaf, is able to penetrate and work in the brain after the oral administration. Ciwujianoside B significantly enhances object recognition memory[1].Ciwujianoside B shows radioprotective effects on the hematopoietic system in mice, which is associated with changes in the cell cycle, reduces DNA damage and down-regulates the ratio of Bax/Bcl-2 in bone marrow cells exposed to radiation[2]. |
| Name | yemuoside YM(10) |
|---|---|
| Synonym | More Synonyms |
| Description | Ciwujianoside B is isolated from Eleutherococcus senticosus leaf, is able to penetrate and work in the brain after the oral administration. Ciwujianoside B significantly enhances object recognition memory[1].Ciwujianoside B shows radioprotective effects on the hematopoietic system in mice, which is associated with changes in the cell cycle, reduces DNA damage and down-regulates the ratio of Bax/Bcl-2 in bone marrow cells exposed to radiation[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C59H94O24 |
| Molecular Weight | 1187.363 |
| Exact Mass | 1186.613525 |
| PSA | 372.36000 |
| LogP | 7.67 |
| Index of Refraction | 1.627 |
| InChIKey | UPROOJBJZLZCGS-CHTHVDMYSA-N |
| SMILES | C=C1CCC2(C(=O)OC3OC(COC4OC(CO)C(OC5OC(C)C(O)C(O)C5O)C(O)C4O)C(O)C(O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OCC(O)C(O)C6OC6OC(C)C(O)C(O)C6O)C(C)(C)C5CCC43C)C2C1 |
| Storage condition | 2-8C |
|
~%
Ciwujianoside B CAS#:114902-16-8 |
| Literature: Shao, Chun-Jie; Kasai, Ryoji; Xu, Jing-Da; Tanaka, Osamu Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 2 p. 601 - 608 |
| 6-Deoxy-α-L-mannopyranosyl-(1->4)-2-deoxy-2-methyl-β-D-glucopyranosyl-(1->6)-1-O-{[(4aS,6aS,6bR,8aR,10S,12aR,12bR,14bS)-10-{[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy}-6 a,6b,9,9,12a-pentamethyl-2-methylene-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydro-4a(2H)-picenyl]carbonyl}-β-D-glucopyranose |
| β-D-Glucopyranose, O-6-deoxy-α-L-mannopyranosyl-(1->4)-O-2-deoxy-2-methyl-β-D-glucopyranosyl-(1->6)-1-O-[[(4aS,6aS,6bR,8aR,10S,12aR,12bR,14bS)-10-[[2-O-(6-deoxy-α-L-mannopyranosyl)-α
 -L-arabinopyranosyl]oxy]-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydro-6a,6b,9,9,12a-pentamethyl-2-methylene-4a(2H)-picenyl]carbonyl]- |
| acanthopanax senticosides B |
| yemuoside YM10 |
| CIWUJIANOSIDE B (RG) |
| Ciwujianoside B |