cytallene structure
|
Common Name | cytallene | ||
|---|---|---|---|---|
| CAS Number | 114987-19-8 | Molecular Weight | 179.17600 | |
| Density | 1.28g/cm3 | Boiling Point | 393.1ºC at 760mmHg | |
| Molecular Formula | C8H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 4-amino-1-(4-hydroxybuta-1,2-dienyl)pyrimidin-2-one |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 393.1ºC at 760mmHg |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.17600 |
| Flash Point | 191.6ºC |
| Exact Mass | 179.06900 |
| PSA | 82.13000 |
| Vapour Pressure | 8.26E-08mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | GHTIVOZHSNRAAW-JZXVYGCJSA-N |
| SMILES | N=C1C=C[N+](=CC=CCO)C([O-])=N1 |
|
~38%
cytallene CAS#:114987-19-8 |
| Literature: Phadtare, Shashikant; Zemlicka, Jiri Journal of the American Chemical Society, 1989 , vol. 111, # 15 p. 5925 - 5931 |
|
~%
cytallene CAS#:114987-19-8 |
| Literature: Phadtare, Shashikant; Zemlicka, Jiri Journal of the American Chemical Society, 1989 , vol. 111, # 15 p. 5925 - 5931 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |