1,3-BENZODIOXOLE-5-SULFONYL CHLORIDE structure
|
Common Name | 1,3-BENZODIOXOLE-5-SULFONYL CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 115010-10-1 | Molecular Weight | 220.63000 | |
| Density | 1.607g/cm3 | Boiling Point | 326.5ºC at 760mmHg | |
| Molecular Formula | C7H5ClO4S | Melting Point | 46-49ºC | |
| MSDS | Chinese USA | Flash Point | 151.3ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Benzo[1,3]dioxole-5-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.607g/cm3 |
|---|---|
| Boiling Point | 326.5ºC at 760mmHg |
| Melting Point | 46-49ºC |
| Molecular Formula | C7H5ClO4S |
| Molecular Weight | 220.63000 |
| Flash Point | 151.3ºC |
| Exact Mass | 219.96000 |
| PSA | 60.98000 |
| LogP | 2.42360 |
| Vapour Pressure | 0.000409mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | ICUBASIDCXDQAW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)OCO2 |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | 14-34-36 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGIII |
| HS Code | 2932999099 |
|
~93%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: G. D. Searle and Co. Patent: US6388132 B1, 2002 ; Location in patent: Page column 52 ; |
|
~%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: US5968942 A1, ; US 5968942 A |
|
~73%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: Eli Lilly and Company Patent: US5387681 A1, 1995 ; |
|
~98%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: The Jordanian Pharmaceutical Manufacturing and Medical Equipment Co.Ltd. Patent: EP1219614 A1, 2002 ; Location in patent: Page 10 ; EP 1219614 A1 |
|
~%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: US6747027 B1, ; |
|
~%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 29 p. 10638 - 10641 |
|
~%
1,3-BENZODIOXOL... CAS#:115010-10-1 |
| Literature: Chemische Berichte, , vol. 128, # 12 p. 1195 - 1198 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-benzodioxole-5-sulfonyl chloride |
| 1,3-Benzodioxole-5-sulfonyl chloride |