2-(4-methoxybenzoyl)benzoic acid structure
|
Common Name | 2-(4-methoxybenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1151-15-1 | Molecular Weight | 256.25300 | |
| Density | 1.255g/cm3 | Boiling Point | 477.6ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | 147-148 | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | 2-(4-methoxybenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 477.6ºC at 760 mmHg |
| Melting Point | 147-148 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 183.5ºC |
| Exact Mass | 256.07400 |
| PSA | 63.60000 |
| LogP | 2.62440 |
| Vapour Pressure | 6.25E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | UIUCGMLLTRXRBF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2C(=O)O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o-(p-Anisoyl)benzoic acid |
| (4'-methoxybenzoyl)benzoic acid |
| 2-(4-methoxybenzoyl)benzenecarboxylic acid |
| 2-(2-OXOBENZO[CD]INDOL-1(2H)-YL)PROPANOIC ACID |
| MFCD00278217 |
| 2-[(4-methoxyphenyl)carbonyl]benzoic acid |
| Benzoic acid,2-(4-methoxybenzoyl) |
| Benzoic acid,o-(p-anisoyl) |
| 2-(4-Methoxy-benzoyl)-benzoic acid |
| o-(4-Methoxybenzoyl)benzoic acid |