tert-butyl 2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate structure
|
Common Name | tert-butyl 2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1151665-15-4 | Molecular Weight | 268.739 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 372.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H17ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.3±27.9 °C | |
| Name | tert-Butyl 2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.9±42.0 °C at 760 mmHg |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.739 |
| Flash Point | 179.3±27.9 °C |
| Exact Mass | 268.097870 |
| PSA | 42.43000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | LPZHKCVGWZFNDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc(Cl)ccc2C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate |
| tert-butyl 2-chloro-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| 1,6-Naphthyridine-6(5H)-carboxylic acid, 2-chloro-7,8-dihydro-, 1,1-dimethylethyl ester |