2,2-Dimethyl-6-phenylpyrano[3,4-b]pyran-8-one structure
|
Common Name | 2,2-Dimethyl-6-phenylpyrano[3,4-b]pyran-8-one | ||
|---|---|---|---|---|
| CAS Number | 1153624-36-2 | Molecular Weight | 254.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2,2-Dimethyl-6-phenylpyrano[3,4-b]pyran-8-one2,2-Dimethyl-6-phenylpyrano[3,4-b]pyran-8-one (Compound 2) is a pyranone isolated from the hexane extract of the aerial parts of Hypericum choisianum[1]. |
| Name | 2,2-Dimethyl-6-phenylpyrano[3,4-b]pyran-8-one |
|---|
| Description | 2,2-Dimethyl-6-phenylpyrano[3,4-b]pyran-8-one (Compound 2) is a pyranone isolated from the hexane extract of the aerial parts of Hypericum choisianum[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H14O3 |
|---|---|
| Molecular Weight | 254.28 |
| InChIKey | LFEBRDXQPYEGIM-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2cc(-c3ccccc3)oc(=O)c2O1 |
| Storage condition | 2-8℃ |