35298-48-7
35298-48-7 structure
- Name: 2,2-Dimethyl-3(2H)-furanone
- Chemical Name: 2,2-dimethylfuran-3-one
- CAS Number: 35298-48-7
- Molecular Formula: C6H8O2
- Molecular Weight: 112.127
- Create Date: 2019-05-14 00:04:49
- Modify Date: 2024-01-02 18:05:42
| Name | 2,2-dimethylfuran-3-one |
|---|---|
| Synonyms |
MFCD00052571
2,2-dimethyl-furan-3-one 3(2H)-Furanone,2,2-dimethyl 2,2-Dimethyl-3(2H)-furanone InChI=1/C6H8O2/c1-6(2)5(7)3-4-8-6/h3-4H,1-2H 2.2-Dimethyl-3(2H)-furanone 3(2H)-Furanone, 2,2-dimethyl- EINECS 238-365-5 2,2-Dimethylfuran-3(2H)-one |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 155.5±20.0 °C at 760 mmHg |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.127 |
| Flash Point | 51.7±0.0 °C |
| Exact Mass | 112.052429 |
| PSA | 26.30000 |
| LogP | 0.28 |
| Vapour Pressure | 3.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.452 |
| Storage condition | 2-8°C |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn |
| Risk Phrases | R10 |
| Safety Phrases | S16-S27-S36/37/39 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2932190090 |
| Precursor 4 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |