1-Decanone,1-(2,3,4-trihydroxyphenyl) structure
|
Common Name | 1-Decanone,1-(2,3,4-trihydroxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 1154-72-9 | Molecular Weight | 280.35900 | |
| Density | 1.129g/cm3 | Boiling Point | 459.9ºC at 760mmHg | |
| Molecular Formula | C16H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.1ºC | |
| Name | 1-(2,3,4-trihydroxyphenyl)decan-1-one |
|---|
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 459.9ºC at 760mmHg |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.35900 |
| Flash Point | 246.1ºC |
| Exact Mass | 280.16700 |
| PSA | 77.76000 |
| LogP | 4.12680 |
| Vapour Pressure | 4.44E-09mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | ZPMQGTUVDYNEHO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)c1ccc(O)c(O)c1O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|