Neopentyl Glycol Bis(4-aminophenyl) Ether structure
|
Common Name | Neopentyl Glycol Bis(4-aminophenyl) Ether | ||
|---|---|---|---|---|
| CAS Number | 115570-52-0 | Molecular Weight | 286.36900 | |
| Density | 1.134g/cm3 | Boiling Point | 472.899ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O2 | Melting Point | 116ºC | |
| MSDS | N/A | Flash Point | 255.903ºC | |
| Name | 4-[3-(4-aminophenoxy)-2,2-dimethylpropoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 472.899ºC at 760 mmHg |
| Melting Point | 116ºC |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.36900 |
| Flash Point | 255.903ºC |
| Exact Mass | 286.16800 |
| PSA | 70.50000 |
| LogP | 4.49740 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | HPUJEBAZZTZOFL-UHFFFAOYSA-N |
| SMILES | CC(C)(COc1ccc(N)cc1)COc1ccc(N)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Bis(4-aminophenoxy)neopentane |
| Neopentyl Glycol Bis(4-aMinophenyl) Ether |
| 2,2-Dimethylpropane 1,3-Bis(4-aminophenyl) Ether |
| N0614 |
| 2,2-Bis[(4-aminophenoxy)methyl]propane |