2,4-Dichloro-5-trifluoromethyl-3-nitrotoluene structure
|
Common Name | 2,4-Dichloro-5-trifluoromethyl-3-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 115571-69-2 | Molecular Weight | 274.02400 | |
| Density | 1.566g/cm3 | Boiling Point | 288.4ºC at 760mmHg | |
| Molecular Formula | C8H4Cl2F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.2ºC | |
| Name | 2,4-dichloro-1-methyl-3-nitro-5-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.566g/cm3 |
|---|---|
| Boiling Point | 288.4ºC at 760mmHg |
| Molecular Formula | C8H4Cl2F3NO2 |
| Molecular Weight | 274.02400 |
| Flash Point | 128.2ºC |
| Exact Mass | 272.95700 |
| PSA | 45.82000 |
| LogP | 4.75200 |
| Vapour Pressure | 0.00407mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | BAKKEOPYMZSUQG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4,5-TRICHLOROANILINE-D4 |
| MFCD06658277 |
| 2,4-dichloro-5-trifluoromethyl-3-nitrotoluene |