Bis(4-nitrophenyl) Sulfone structure
|
Common Name | Bis(4-nitrophenyl) Sulfone | ||
|---|---|---|---|---|
| CAS Number | 1156-50-9 | Molecular Weight | 308.267 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 541.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H8N2O6S | Melting Point | 178-185ºC | |
| MSDS | N/A | Flash Point | 281.0±25.9 °C | |
| Name | Bis(4-nitrophenyl) Sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.1±35.0 °C at 760 mmHg |
| Melting Point | 178-185ºC |
| Molecular Formula | C12H8N2O6S |
| Molecular Weight | 308.267 |
| Flash Point | 281.0±25.9 °C |
| Exact Mass | 308.010315 |
| PSA | 134.16000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | BVHNGWRPAFKGFP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Risk Phrases | R20/21/22 |
|---|---|
| Safety Phrases | S22;S36/S37/S39 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Inhibition of SARS coronavirus main protease
Source: ChEMBL
Target: Replicase polyprotein 1a
External Id: CHEMBL854506
|
|
Name: SARS-CoV 3CL Protease Inhibition Assay from Article 10.1021/jm060207o: "Structure-bas...
Source: BindingDB
Target: N/A
External Id: BindingDB_1401_1
|
| Bis(4-nitrophenyl) Sulfone |
| 1-nitro-4-[(4-nitrophenyl)sulfonyl]benzene |
| 1,1'-Sulfonylbis(4-nitrobenzene) |
| EINECS 214-589-9 |
| 1-nitro-4-(4-nitrophenyl)sulfonylbenzene |
| 4,4'-Dinitrodiphenyl Sulfone |